C30H36FN6O7P — CID 174086408
pentyl (2R)-2-[[[(3R,4R,6S)-6-(6-amino-2-methylpurin-9-yl)-1-fluoro-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 174086408) has the molecular formula C30H36FN6O7P and a molecular weight of 642.63 g/mol. Its IUPAC name is pentyl (2R)-2-[[[(3R,4R,6S)-6-(6-amino-2-methylpurin-9-yl)-1-fluoro-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | pentyl (2R)-2-[[[(3R,4R,6S)-6-(6-amino-2-methylpurin-9-yl)-1-fluoro-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174086408 |
| Molecular Formula | C30H36FN6O7P |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | pentyl (2R)-2-[[[(3R,4R,6S)-6-(6-amino-2-methylpurin-9-yl)-1-fluoro-4-hydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCCOC(=O)[C@@H](C)NP(=O)(OC[C@H]1OC2(F)C(C1O)[C@@H]2n1cnc2c(N)nc(C)nc21)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C30H36FN6O7P/c1-4-5-8-14-41-29(39)17(2)36-45(40,44-21-13-9-11-19-10-6-7-12-20(19)21)42-15-22-25(38)23-26(30(23,31)43-22)37-16-33-24-27(32)34-18(3)35-28(24)37/h6-7,9-13,16-17,22-23,25-26,38H,4-5,8,14-15H2,1-3H3,(H,36,40)(H2,32,34,35)/t17-,22-,23?,25?,26+,30?,45?/m1/s1 |
| InChIKey | YUTXYFUDYSOFJO-UCNWDGGNSA-N |
| XLogP | 4.38 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|