C21H42B2O4 — CID 174087037
2-tert-butyl-4,4,5-trimethyl-5-[2-(4,5,5-trimethyl-2-pentyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborolane (PubChem CID 174087037) has the molecular formula C21H42B2O4 and a molecular weight of 380.19 g/mol. Its IUPAC name is 2-tert-butyl-4,4,5-trimethyl-5-[2-(4,5,5-trimethyl-2-pentyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborolane.
| Compound Name | 2-tert-butyl-4,4,5-trimethyl-5-[2-(4,5,5-trimethyl-2-pentyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174087037 |
| Molecular Formula | C21H42B2O4 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | 2-tert-butyl-4,4,5-trimethyl-5-[2-(4,5,5-trimethyl-2-pentyl-1,3,2-dioxaborolan-4-yl)ethyl]-1,3,2-dioxaborolane |
| SMILES | CCCCCB1OC(C)(C)C(C)(CCC2(C)OB(C(C)(C)C)OC2(C)C)O1 |
| InChI | InChI=1S/C21H42B2O4/c1-11-12-13-16-22-24-18(5,6)20(9,26-22)14-15-21(10)19(7,8)25-23(27-21)17(2,3)4/h11-16H2,1-10H3 |
| InChIKey | QZBZJEVGNBDKDQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|