C13H14F2N4O4S — CID 17409066
3-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylsulfanyl]-4,5-dimethyl-1,2,4-triazole (PubChem CID 17409066) has the molecular formula C13H14F2N4O4S and a molecular weight of 360.34 g/mol. Its IUPAC name is 3-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylsulfanyl]-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylsulfanyl]-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17409066 |
| Molecular Formula | C13H14F2N4O4S |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 3-[[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]methylsulfanyl]-4,5-dimethyl-1,2,4-triazole |
| SMILES | COc1cc(CSc2nnc(C)n2C)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C13H14F2N4O4S/c1-7-16-17-13(18(7)2)24-6-8-4-10(22-3)11(23-12(14)15)5-9(8)19(20)21/h4-5,12H,6H2,1-3H3 |
| InChIKey | MPUNNFHEGYZXJR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|