C27H29N3O4 — CID 174098870
3-[6-[(Z)-2-(morpholin-4-ylmethylidene)hex-3-enyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 174098870) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-[6-[(Z)-2-(morpholin-4-ylmethylidene)hex-3-enyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(Z)-2-(morpholin-4-ylmethylidene)hex-3-enyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174098870 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-[6-[(Z)-2-(morpholin-4-ylmethylidene)hex-3-enyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | CC/C=C\C(=CN1CCOCC1)Cc1ccc2c3c(cccc13)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C27H29N3O4/c1-2-3-5-18(17-29-12-14-34-15-13-29)16-19-8-9-22-25-20(19)6-4-7-21(25)27(33)30(22)23-10-11-24(31)28-26(23)32/h3-9,17,23H,2,10-16H2,1H3,(H,28,31,32)/b5-3-,18-17? |
| InChIKey | UAJFWMYVELYTKS-OCGFBOIMSA-N |
| XLogP | 3.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|