C28H46BN3O4 — CID 174106360
4-tert-butyl-4-[methyl-[[(3R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-3-yl]methyl]amino]piperidine-1-carboxylic acid (PubChem CID 174106360) has the molecular formula C28H46BN3O4 and a molecular weight of 499.51 g/mol. Its IUPAC name is 4-tert-butyl-4-[methyl-[[(3R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-3-yl]methyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-tert-butyl-4-[methyl-[[(3R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-3-yl]methyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174106360 |
| Molecular Formula | C28H46BN3O4 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.36 |
| IUPAC Name | 4-tert-butyl-4-[methyl-[[(3R)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-3-yl]methyl]amino]piperidine-1-carboxylic acid |
| SMILES | CN(C[C@H]1CCN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C1(C(C)(C)C)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C28H46BN3O4/c1-25(2,3)28(14-17-31(18-15-28)24(33)34)30(8)19-21-13-16-32(20-21)23-11-9-22(10-12-23)29-35-26(4,5)27(6,7)36-29/h9-12,21H,13-20H2,1-8H3,(H,33,34)/t21-/m1/s1 |
| InChIKey | UORLHYFZBIQOKI-OAQYLSRUSA-N |
| XLogP | 4.30 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|