C29H47BrO4Si — CID 174150566
methyl (Z)-6-bromo-7-[(1R,2R,3R)-2-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 174150566) has the molecular formula C29H47BrO4Si and a molecular weight of 567.68 g/mol. Its IUPAC name is methyl (Z)-6-bromo-7-[(1R,2R,3R)-2-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-6-bromo-7-[(1R,2R,3R)-2-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 174150566 |
| Molecular Formula | C29H47BrO4Si |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | methyl (Z)-6-bromo-7-[(1R,2R,3R)-2-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CC#CC[C@H](C)[C@@H](/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1C/C(Br)=C/CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H47BrO4Si/c1-10-11-14-21(2)27(34-35(8,9)29(4,5)6)18-17-24-22(3)19-26(31)25(24)20-23(30)15-12-13-16-28(32)33-7/h15,17-18,21-22,24-25,27H,12-14,16,19-20H2,1-9H3/b18-17+,23-15-/t21-,22+,24-,25+,27+/m0/s1 |
| InChIKey | RMNNTCBGJHPKTQ-WDWGVKLOSA-N |
| XLogP | 7.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|