C20H20N2 — CID 174153049
(E)-N-[(E)-(2-methyl-5,6-dihydronaphthalen-1-yl)methylideneamino]-1-phenylethanimine (PubChem CID 174153049) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (E)-N-[(E)-(2-methyl-5,6-dihydronaphthalen-1-yl)methylideneamino]-1-phenylethanimine.
| Compound Name | (E)-N-[(E)-(2-methyl-5,6-dihydronaphthalen-1-yl)methylideneamino]-1-phenylethanimine |
|---|---|
| PubChem CID | 174153049 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (E)-N-[(E)-(2-methyl-5,6-dihydronaphthalen-1-yl)methylideneamino]-1-phenylethanimine |
| SMILES | C/C(=N/N=C/c1c(C)ccc2c1C=CCC2)c1ccccc1 |
| InChI | InChI=1S/C20H20N2/c1-15-12-13-18-10-6-7-11-19(18)20(15)14-21-22-16(2)17-8-4-3-5-9-17/h3-5,7-9,11-14H,6,10H2,1-2H3/b21-14+,22-16- |
| InChIKey | UWFCMBBRSPMWAM-AOOUSOOLSA-N |
| XLogP | 4.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|