C19H36Br2O2 — CID 174162333
2-[5,5-dibromo-1-methoxy-2-(methoxymethyl)hexan-2-yl]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 174162333) has the molecular formula C19H36Br2O2 and a molecular weight of 456.30 g/mol. Its IUPAC name is 2-[5,5-dibromo-1-methoxy-2-(methoxymethyl)hexan-2-yl]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | 2-[5,5-dibromo-1-methoxy-2-(methoxymethyl)hexan-2-yl]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 174162333 |
| Molecular Formula | C19H36Br2O2 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-[5,5-dibromo-1-methoxy-2-(methoxymethyl)hexan-2-yl]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | COCC(CCC(C)(Br)Br)(COC)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C19H36Br2O2/c1-14(2)16-8-7-15(3)11-17(16)19(12-22-5,13-23-6)10-9-18(4,20)21/h14-17H,7-13H2,1-6H3 |
| InChIKey | YUQXBVRIXVBDOX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|