C22H36O5 — CID 174163989
(E)-7-[(3R)-6-hydroxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]hept-5-enoic acid (PubChem CID 174163989) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (E)-7-[(3R)-6-hydroxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[(3R)-6-hydroxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 174163989 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (E)-7-[(3R)-6-hydroxy-4-[2-(3-methylbut-2-enoxy)propan-2-yl]-1-oxaspiro[2.5]octan-6-yl]hept-5-enoic acid |
| SMILES | CC(C)=CCOC(C)(C)C1CC(O)(C/C=C/CCCC(=O)O)CC[C@]12CO2 |
| InChI | InChI=1S/C22H36O5/c1-17(2)10-14-26-20(3,4)18-15-21(25,12-13-22(18)16-27-22)11-8-6-5-7-9-19(23)24/h6,8,10,18,25H,5,7,9,11-16H2,1-4H3,(H,23,24)/b8-6+/t18?,21?,22-/m0/s1 |
| InChIKey | HZKWFGCERZORLP-XQNRHCIDSA-N |
| XLogP | 4.25 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|