C23H17Cl2F2N5O4 — CID 174177593
2-[3,5-dichloro-4-[[2-(2,2-difluoroethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-5-methylidene-3-oxo-1,2,4-triazine-6-carbonitrile (PubChem CID 174177593) has the molecular formula C23H17Cl2F2N5O4 and a molecular weight of 536.32 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[2-(2,2-difluoroethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-5-methylidene-3-oxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[2-(2,2-difluoroethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-5-methylidene-3-oxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 174177593 |
| Molecular Formula | C23H17Cl2F2N5O4 |
| Molecular Weight | 536.32 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 2-[3,5-dichloro-4-[[2-(2,2-difluoroethoxymethyl)-1-oxo-3,4-dihydroisoquinolin-6-yl]oxy]phenyl]-5-methylidene-3-oxo-1,2,4-triazine-6-carbonitrile |
| SMILES | C=C1NC(=O)N(c2cc(Cl)c(Oc3ccc4c(c3)CCN(COCC(F)F)C4=O)c(Cl)c2)N=C1C#N |
| InChI | InChI=1S/C23H17Cl2F2N5O4/c1-12-19(9-28)30-32(23(34)29-12)14-7-17(24)21(18(25)8-14)36-15-2-3-16-13(6-15)4-5-31(22(16)33)11-35-10-20(26)27/h2-3,6-8,20H,1,4-5,10-11H2,(H,29,34) |
| InChIKey | JCZZJURYOMKMNR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |