C21H25N3O6 — CID 174183186
2-aminopropan-2-yl 4-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutanoate (PubChem CID 174183186) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-aminopropan-2-yl 4-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutanoate.
| Compound Name | 2-aminopropan-2-yl 4-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutanoate |
|---|---|
| PubChem CID | 174183186 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-aminopropan-2-yl 4-[2-(6-methylidene-2-oxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutanoate |
| SMILES | C=C1CCC(N2C(=O)c3cccc(OCCCC(=O)OC(C)(C)N)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25N3O6/c1-12-9-10-14(18(26)23-12)24-19(27)13-6-4-7-15(17(13)20(24)28)29-11-5-8-16(25)30-21(2,3)22/h4,6-7,14H,1,5,8-11,22H2,2-3H3,(H,23,26) |
| InChIKey | ZNJRZZGBJNROKX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|