C23H38BrN2O12P — CID 174184889
[3-[[(2R)-3-acetyloxy-2-carbonobromidoyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(cyclopropylmethylamino)propanoyloxy]propyl] 3-(cyclopropylmethylamino)propanoate (PubChem CID 174184889) has the molecular formula C23H38BrN2O12P and a molecular weight of 645.44 g/mol. Its IUPAC name is [3-[[(2R)-3-acetyloxy-2-carbonobromidoyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(cyclopropylmethylamino)propanoyloxy]propyl] 3-(cyclopropylmethylamino)propanoate.
| Compound Name | [3-[[(2R)-3-acetyloxy-2-carbonobromidoyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(cyclopropylmethylamino)propanoyloxy]propyl] 3-(cyclopropylmethylamino)propanoate |
|---|---|
| PubChem CID | 174184889 |
| Molecular Formula | C23H38BrN2O12P |
| Molecular Weight | 645.44 g/mol |
| Exact Mass | 644.13 |
| IUPAC Name | [3-[[(2R)-3-acetyloxy-2-carbonobromidoyloxypropoxy]-hydroxyphosphoryl]oxy-2-[3-(cyclopropylmethylamino)propanoyloxy]propyl] 3-(cyclopropylmethylamino)propanoate |
| SMILES | CC(=O)OC[C@H](COP(=O)(O)OCC(COC(=O)CCNCC1CC1)OC(=O)CCNCC1CC1)OC(=O)Br |
| InChI | InChI=1S/C23H38BrN2O12P/c1-16(27)33-12-20(38-23(24)30)15-36-39(31,32)35-14-19(37-22(29)7-9-26-11-18-4-5-18)13-34-21(28)6-8-25-10-17-2-3-17/h17-20,25-26H,2-15H2,1H3,(H,31,32)/t19?,20-/m1/s1 |
| InChIKey | SCVRVQHTUZPSCI-GFOWMXPYSA-N |
| XLogP | 1.82 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|