molecular hydrogen;naphthalen-1-ylphosphane

C10H13P — CID 174185570

IUPACmolecular hydrogen;naphthalen-1-ylphosphane
SMILESPc1cccc2ccccc12.[H][H].[H][H]
InChIInChI=1S/C10H9P.2H2/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,11H2;2*1H
InChIKeyAZEIPEBMJFAZTR-UHFFFAOYSA-N
MW164.19 g/mol
LogP2.83
Rot. Bonds

About molecular hydrogen;naphthalen-1-ylphosphane

molecular hydrogen;naphthalen-1-ylphosphane (PubChem CID 174185570) has the molecular formula C10H13P and a molecular weight of 164.19 g/mol. Its IUPAC name is molecular hydrogen;naphthalen-1-ylphosphane.

Molecular Properties

Compound Namemolecular hydrogen;naphthalen-1-ylphosphane
PubChem CID174185570
Molecular FormulaC10H13P
Molecular Weight164.19 g/mol
Exact Mass164.08
IUPAC Namemolecular hydrogen;naphthalen-1-ylphosphane
SMILESPc1cccc2ccccc12.[H][H].[H][H]
InChIInChI=1S/C10H9P.2H2/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,11H2;2*1H
InChIKeyAZEIPEBMJFAZTR-UHFFFAOYSA-N
XLogP2.83
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.19
LogP ≤ 52.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze molecular hydrogen;naphthalen-1-ylphosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;naphthalen-1-ylphosphane?
The IUPAC name of molecular hydrogen;naphthalen-1-ylphosphane (CID 174185570) is molecular hydrogen;naphthalen-1-ylphosphane.
What is the SMILES notation for molecular hydrogen;naphthalen-1-ylphosphane?
The canonical SMILES for molecular hydrogen;naphthalen-1-ylphosphane is Pc1cccc2ccccc12.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;naphthalen-1-ylphosphane?
The InChIKey is AZEIPEBMJFAZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9P.2H2/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,11H2;2*1H.
What are the key properties of molecular hydrogen;naphthalen-1-ylphosphane?
molecular hydrogen;naphthalen-1-ylphosphane has a molecular weight of 164.19 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;naphthalen-1-ylphosphane is sourced from PubChem (CID 174185570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).