C13H18N2 — CID 174190362
1,2,3,4,4a,5,10,10a-octahydroacridin-1-amine (PubChem CID 174190362) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,2,3,4,4a,5,10,10a-octahydroacridin-1-amine.
| Compound Name | 1,2,3,4,4a,5,10,10a-octahydroacridin-1-amine |
|---|---|
| PubChem CID | 174190362 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,2,3,4,4a,5,10,10a-octahydroacridin-1-amine |
| SMILES | NC1CCCC2NC3CC=CC=C3C=C12 |
| InChI | InChI=1S/C13H18N2/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13/h1-2,4,8,11-13,15H,3,5-7,14H2 |
| InChIKey | RQYLEPLGCOQNNO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |