C42H34O4 — CID 174195843
[(1S,4S)-3-benzoyloxy-1-methyl-7-phenyl-4-(3-phenylcyclopenta-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate (PubChem CID 174195843) has the molecular formula C42H34O4 and a molecular weight of 602.73 g/mol. Its IUPAC name is [(1S,4S)-3-benzoyloxy-1-methyl-7-phenyl-4-(3-phenylcyclopenta-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate.
| Compound Name | [(1S,4S)-3-benzoyloxy-1-methyl-7-phenyl-4-(3-phenylcyclopenta-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 174195843 |
| Molecular Formula | C42H34O4 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | [(1S,4S)-3-benzoyloxy-1-methyl-7-phenyl-4-(3-phenylcyclopenta-2,4-dien-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl] benzoate |
| SMILES | C[C@H]1c2cc(-c3ccccc3)ccc2[C@H](C2C=CC(c3ccccc3)=C2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H34O4/c1-28-37-27-34(30-16-8-3-9-17-30)24-25-36(37)38(35-23-22-33(26-35)29-14-6-2-7-15-29)40(46-42(44)32-20-12-5-13-21-32)39(28)45-41(43)31-18-10-4-11-19-31/h2-28,35,38-40H,1H3/t28-,35?,38-,39?,40?/m0/s1 |
| InChIKey | MBEZEESJKMZCLV-CUJMAYIHSA-N |
| XLogP | 9.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |