C17H25N3O2 — CID 174199425
3-[(E)-2-[amino-[(3R,4R)-5-oxaspiro[3.5]nonan-3-yl]amino]ethenyl]-2-methoxyaniline (PubChem CID 174199425) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-[(E)-2-[amino-[(3R,4R)-5-oxaspiro[3.5]nonan-3-yl]amino]ethenyl]-2-methoxyaniline.
| Compound Name | 3-[(E)-2-[amino-[(3R,4R)-5-oxaspiro[3.5]nonan-3-yl]amino]ethenyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 174199425 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-[(E)-2-[amino-[(3R,4R)-5-oxaspiro[3.5]nonan-3-yl]amino]ethenyl]-2-methoxyaniline |
| SMILES | COc1c(N)cccc1/C=C/N(N)[C@@H]1CC[C@]12CCCCO2 |
| InChI | InChI=1S/C17H25N3O2/c1-21-16-13(5-4-6-14(16)18)8-11-20(19)15-7-10-17(15)9-2-3-12-22-17/h4-6,8,11,15H,2-3,7,9-10,12,18-19H2,1H3/b11-8+/t15-,17-/m1/s1 |
| InChIKey | MPVDPADOQPSZMA-BQWPMLRZSA-N |
| XLogP | 2.53 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|