C24H32O11 — CID 174203558
3-(oxiran-2-ylmethoxy)-6-[[3-[3-[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methoxymethyl]oxiran-2-yl]oxiran-2-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 174203558) has the molecular formula C24H32O11 and a molecular weight of 496.51 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)-6-[[3-[3-[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methoxymethyl]oxiran-2-yl]oxiran-2-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | 3-(oxiran-2-ylmethoxy)-6-[[3-[3-[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methoxymethyl]oxiran-2-yl]oxiran-2-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 174203558 |
| Molecular Formula | C24H32O11 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)-6-[[3-[3-[[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]methoxymethyl]oxiran-2-yl]oxiran-2-yl]methoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | c1cc(COCC2OC2C2OC2COC2COC3C(OCC4CO4)COC23)oc1COCC1CO1 |
| InChI | InChI=1S/C24H32O11/c1-2-14(33-13(1)3-25-5-15-6-27-15)4-26-9-19-23(34-19)24-20(35-24)12-30-18-11-32-21-17(10-31-22(18)21)29-8-16-7-28-16/h1-2,15-24H,3-12H2 |
| InChIKey | XOVJZNIREKQHAJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|