C10H11NO3 — CID 132508479
2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]acetonitrile (PubChem CID 132508479) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]acetonitrile.
| Compound Name | 2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]acetonitrile |
|---|---|
| PubChem CID | 132508479 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]acetonitrile |
| SMILES | N#CCc1ccc(COCC2CO2)o1 |
| InChI | InChI=1S/C10H11NO3/c11-4-3-8-1-2-9(14-8)5-12-6-10-7-13-10/h1-2,10H,3,5-7H2 |
| InChIKey | CAMOAHCHRBVGFN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|