C18H26O7 — CID 177315409
5-ethyl-5-(oxiran-2-ylmethoxymethyl)-2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]-1,3-dioxane (PubChem CID 177315409) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is 5-ethyl-5-(oxiran-2-ylmethoxymethyl)-2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]-1,3-dioxane.
| Compound Name | 5-ethyl-5-(oxiran-2-ylmethoxymethyl)-2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 177315409 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-ethyl-5-(oxiran-2-ylmethoxymethyl)-2-[5-(oxiran-2-ylmethoxymethyl)furan-2-yl]-1,3-dioxane |
| SMILES | CCC1(COCC2CO2)COC(c2ccc(COCC3CO3)o2)OC1 |
| InChI | InChI=1S/C18H26O7/c1-2-18(10-20-7-15-9-22-15)11-23-17(24-12-18)16-4-3-13(25-16)5-19-6-14-8-21-14/h3-4,14-15,17H,2,5-12H2,1H3 |
| InChIKey | XOYKXQDZYLOXOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|