C14H17F3N2O3S — CID 174206065
tert-butyl-[1-[3-(carboxyamino)-5-(trifluoromethyl)phenyl]ethylideneamino]-oxidosulfanium (PubChem CID 174206065) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is tert-butyl-[1-[3-(carboxyamino)-5-(trifluoromethyl)phenyl]ethylideneamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[3-(carboxyamino)-5-(trifluoromethyl)phenyl]ethylideneamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174206065 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | tert-butyl-[1-[3-(carboxyamino)-5-(trifluoromethyl)phenyl]ethylideneamino]-oxidosulfanium |
| SMILES | CC(=N[S+]([O-])C(C)(C)C)c1cc(NC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3S/c1-8(19-23(22)13(2,3)4)9-5-10(14(15,16)17)7-11(6-9)18-12(20)21/h5-7,18H,1-4H3,(H,20,21) |
| InChIKey | BHVFITFXZLLOSD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|