C24H24F9N5O2S — CID 174220455
1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[2,2,2-trifluoro-1-[5-(7-methoxypyrazolo[1,5-a]pyridin-5-yl)-6-methylsulfanyl-3-pyridinyl]ethyl]urea (PubChem CID 174220455) has the molecular formula C24H24F9N5O2S and a molecular weight of 617.54 g/mol. Its IUPAC name is 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[2,2,2-trifluoro-1-[5-(7-methoxypyrazolo[1,5-a]pyridin-5-yl)-6-methylsulfanyl-3-pyridinyl]ethyl]urea.
| Compound Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[2,2,2-trifluoro-1-[5-(7-methoxypyrazolo[1,5-a]pyridin-5-yl)-6-methylsulfanyl-3-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 174220455 |
| Molecular Formula | C24H24F9N5O2S |
| Molecular Weight | 617.54 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 1-ethyl-3-(1,1,1,5,5,5-hexafluoropentan-2-yl)-1-[2,2,2-trifluoro-1-[5-(7-methoxypyrazolo[1,5-a]pyridin-5-yl)-6-methylsulfanyl-3-pyridinyl]ethyl]urea |
| SMILES | CCN(C(=O)NC(CCC(F)(F)F)C(F)(F)F)C(c1cnc(SC)c(-c2cc(OC)n3nccc3c2)c1)C(F)(F)F |
| InChI | InChI=1S/C24H24F9N5O2S/c1-4-37(21(39)36-17(23(28,29)30)5-7-22(25,26)27)19(24(31,32)33)14-10-16(20(41-3)34-12-14)13-9-15-6-8-35-38(15)18(11-13)40-2/h6,8-12,17,19H,4-5,7H2,1-3H3,(H,36,39) |
| InChIKey | BSWLENHEIDZZPF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |