C15H16N4O — CID 174220561
1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethanamine (PubChem CID 174220561) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethanamine.
| Compound Name | 1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 174220561 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethanamine |
| SMILES | COc1nc(-c2cccc(C(C)N)c2)cn2ccnc12 |
| InChI | InChI=1S/C15H16N4O/c1-10(16)11-4-3-5-12(8-11)13-9-19-7-6-17-14(19)15(18-13)20-2/h3-10H,16H2,1-2H3 |
| InChIKey | MMRAAIVRDKGWOS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |