C15H16N6O2 — CID 175752769
1-[2-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-4-pyridinyl]ethylurea (PubChem CID 175752769) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1-[2-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-4-pyridinyl]ethylurea.
| Compound Name | 1-[2-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-4-pyridinyl]ethylurea |
|---|---|
| PubChem CID | 175752769 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[2-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-4-pyridinyl]ethylurea |
| SMILES | COc1nc(-c2cc(C(C)NC(N)=O)ccn2)cn2ccnc12 |
| InChI | InChI=1S/C15H16N6O2/c1-9(19-15(16)22)10-3-4-17-11(7-10)12-8-21-6-5-18-13(21)14(20-12)23-2/h3-9H,1-2H3,(H3,16,19,22) |
| InChIKey | ZJTPFYNWEHLGBZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |