C24H22F4N4O3 — CID 174230901
2-[(1S,3R)-4,4-difluoro-3-(1-oxidopyridin-1-ium-4-yl)cyclohexyl]-N-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-pyridinyl]propanamide (PubChem CID 174230901) has the molecular formula C24H22F4N4O3 and a molecular weight of 490.46 g/mol. Its IUPAC name is 2-[(1S,3R)-4,4-difluoro-3-(1-oxidopyridin-1-ium-4-yl)cyclohexyl]-N-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-pyridinyl]propanamide.
| Compound Name | 2-[(1S,3R)-4,4-difluoro-3-(1-oxidopyridin-1-ium-4-yl)cyclohexyl]-N-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 174230901 |
| Molecular Formula | C24H22F4N4O3 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-[(1S,3R)-4,4-difluoro-3-(1-oxidopyridin-1-ium-4-yl)cyclohexyl]-N-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-pyridinyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Oc2ncc(F)cc2F)cn1)[C@H]1CCC(F)(F)[C@@H](c2cc[n+]([O-])cc2)C1 |
| InChI | InChI=1S/C24H22F4N4O3/c1-14(16-4-7-24(27,28)19(10-16)15-5-8-32(34)9-6-15)22(33)31-21-3-2-18(13-29-21)35-23-20(26)11-17(25)12-30-23/h2-3,5-6,8-9,11-14,16,19H,4,7,10H2,1H3,(H,29,31,33)/t14?,16-,19+/m0/s1 |
| InChIKey | QOBHNMBCWGUTSQ-WHJCRDCLSA-N |
| XLogP | 4.97 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|