C23H30N2O5 — CID 174262169
12-methylspiro[8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-triene-14,5'-morpholine]-3',10-dione (PubChem CID 174262169) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 12-methylspiro[8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-triene-14,5'-morpholine]-3',10-dione.
| Compound Name | 12-methylspiro[8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-triene-14,5'-morpholine]-3',10-dione |
|---|---|
| PubChem CID | 174262169 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 12-methylspiro[8,17-dioxa-11-azatetracyclo[16.2.2.02,7.011,15]docosa-2,4,6-triene-14,5'-morpholine]-3',10-dione |
| SMILES | CC1CC2(COCC(=O)N2)C2COC3CCC(CC3)c3ccccc3OCC(=O)N12 |
| InChI | InChI=1S/C23H30N2O5/c1-15-10-23(14-28-12-21(26)24-23)20-11-29-17-8-6-16(7-9-17)18-4-2-3-5-19(18)30-13-22(27)25(15)20/h2-5,15-17,20H,6-14H2,1H3,(H,24,26) |
| InChIKey | MEURNIRVIWILBO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |