C23H29FN2O5 — CID 174260492
(15S,16R)-2'-fluorospiro[8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione (PubChem CID 174260492) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is (15S,16R)-2'-fluorospiro[8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione.
| Compound Name | (15S,16R)-2'-fluorospiro[8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione |
|---|---|
| PubChem CID | 174260492 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (15S,16R)-2'-fluorospiro[8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-15,5'-morpholine]-3',10-dione |
| SMILES | O=C1N[C@]2(CCCN3C(=O)COc4ccccc4C4CCC(CC4)OC[C@H]32)COC1F |
| InChI | InChI=1S/C23H29FN2O5/c24-21-22(28)25-23(14-31-21)10-3-11-26-19(23)12-29-16-8-6-15(7-9-16)17-4-1-2-5-18(17)30-13-20(26)27/h1-2,4-5,15-16,19,21H,3,6-14H2,(H,25,28)/t15?,16?,19-,21?,23+/m0/s1 |
| InChIKey | QRZJWMLPWOTTEM-ANGZUAITSA-N |
| XLogP | 2.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |