C23H29F3N2O4 — CID 177299736
2-(trifluoromethyl)spiro[1,3-oxazolidine-4,15'-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene]-10'-one (PubChem CID 177299736) has the molecular formula C23H29F3N2O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-(trifluoromethyl)spiro[1,3-oxazolidine-4,15'-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene]-10'-one.
| Compound Name | 2-(trifluoromethyl)spiro[1,3-oxazolidine-4,15'-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene]-10'-one |
|---|---|
| PubChem CID | 177299736 |
| Molecular Formula | C23H29F3N2O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-(trifluoromethyl)spiro[1,3-oxazolidine-4,15'-8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene]-10'-one |
| SMILES | O=C1COc2ccccc2C2CCC(CC2)OCC2N1CCCC21COC(C(F)(F)F)N1 |
| InChI | InChI=1S/C23H29F3N2O4/c24-23(25,26)21-27-22(14-32-21)10-3-11-28-19(22)12-30-16-8-6-15(7-9-16)17-4-1-2-5-18(17)31-13-20(28)29/h1-2,4-5,15-16,19,21,27H,3,6-14H2 |
| InChIKey | GTITVSYEBDMKEZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |