C19H36O3Si — CID 174290806
2-(2-cyclohex-3-en-1-ylethyl)-1,1,2-triethoxysilinane (PubChem CID 174290806) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 2-(2-cyclohex-3-en-1-ylethyl)-1,1,2-triethoxysilinane.
| Compound Name | 2-(2-cyclohex-3-en-1-ylethyl)-1,1,2-triethoxysilinane |
|---|---|
| PubChem CID | 174290806 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-(2-cyclohex-3-en-1-ylethyl)-1,1,2-triethoxysilinane |
| SMILES | CCOC1(CCC2CC=CCC2)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C19H36O3Si/c1-4-20-19(16-14-18-12-8-7-9-13-18)15-10-11-17-23(19,21-5-2)22-6-3/h7-8,18H,4-6,9-17H2,1-3H3 |
| InChIKey | CRMFNYLIFYXRKE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|