C27H33N5O7 — CID 174307190
2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl N-(1-amino-3-tricyclo[3.3.1.03,7]nonanyl)carbamate (PubChem CID 174307190) has the molecular formula C27H33N5O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl N-(1-amino-3-tricyclo[3.3.1.03,7]nonanyl)carbamate.
| Compound Name | 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl N-(1-amino-3-tricyclo[3.3.1.03,7]nonanyl)carbamate |
|---|---|
| PubChem CID | 174307190 |
| Molecular Formula | C27H33N5O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethyl N-(1-amino-3-tricyclo[3.3.1.03,7]nonanyl)carbamate |
| SMILES | NC12CC3CC(C1)C(NC(=O)OCCOCCNc1cccc4c1C(=O)N(C1CCC(=O)NC1=O)C4=O)(C3)C2 |
| InChI | InChI=1S/C27H33N5O7/c28-26-11-15-10-16(13-26)27(12-15,14-26)31-25(37)39-9-8-38-7-6-29-18-3-1-2-17-21(18)24(36)32(23(17)35)19-4-5-20(33)30-22(19)34/h1-3,15-16,19,29H,4-14,28H2,(H,31,37)(H,30,33,34) |
| InChIKey | GLQZTCHLKAPROC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 169.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|