C19H23BrN4O2S — CID 17431619
[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone (PubChem CID 17431619) has the molecular formula C19H23BrN4O2S and a molecular weight of 451.39 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 17431619 |
| Molecular Formula | C19H23BrN4O2S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-2-pyridinyl)methanone |
| SMILES | O=C(c1cc(N2CCOCC2)ccn1)N1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C19H23BrN4O2S/c20-18-2-1-16(27-18)14-22-5-7-24(8-6-22)19(25)17-13-15(3-4-21-17)23-9-11-26-12-10-23/h1-4,13H,5-12,14H2 |
| InChIKey | OXVLLZYYEAJMDE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |