About 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol
3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol (PubChem CID 174328969) has the molecular formula C21H34O
and a molecular weight of 302.50 g/mol. Its IUPAC name is 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol.
Molecular Properties
| Compound Name | 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol |
| PubChem CID | 174328969 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol |
| SMILES | CC(C)(C)C1CC2CC2C1.CCCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O.C10H18/c1-2-3-4-5-10-6-8-11(12)9-7-10;1-10(2,3)9-5-7-4-8(7)6-9/h6-9,12H,2-5H2,1H3;7-9H,4-6H2,1-3H3 |
| InChIKey | PTUXHHGHYVGAIP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol?
The IUPAC name of 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol (CID 174328969) is 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol.
What is the SMILES notation for 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol?
The canonical SMILES for 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol is CC(C)(C)C1CC2CC2C1.CCCCCc1ccc(O)cc1.
What is the InChIKey of 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol?
The InChIKey is PTUXHHGHYVGAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C10H18/c1-2-3-4-5-10-6-8-11(12)9-7-10;1-10(2,3)9-5-7-4-8(7)6-9/h6-9,12H,2-5H2,1H3;7-9H,4-6H2,1-3H3.
What are the key properties of 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol?
3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol has a molecular weight of 302.50 g/mol, XLogP of 6.20, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylbicyclo[3.1.0]hexane;4-pentylphenol is sourced from PubChem (CID 174328969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).