C32H43N7O2 — CID 174332489
(1R,9R)-1,11,11-trimethyl-8-[6-[1-(methylamino)cyclopropyl]-2-pyridinyl]-N-[(2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-yl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 174332489) has the molecular formula C32H43N7O2 and a molecular weight of 557.74 g/mol. Its IUPAC name is (1R,9R)-1,11,11-trimethyl-8-[6-[1-(methylamino)cyclopropyl]-2-pyridinyl]-N-[(2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-yl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R)-1,11,11-trimethyl-8-[6-[1-(methylamino)cyclopropyl]-2-pyridinyl]-N-[(2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-yl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 174332489 |
| Molecular Formula | C32H43N7O2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | (1R,9R)-1,11,11-trimethyl-8-[6-[1-(methylamino)cyclopropyl]-2-pyridinyl]-N-[(2E,4Z)-6-morpholin-4-ylhepta-2,4,6-trien-3-yl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
| SMILES | C=C(/C=C\C(=C/C)Nc1ncc2c(n1)N(c1cccc(C3(NC)CC3)n1)[C@@H]1CC(C)(C)OC[C@]21C)N1CCOCC1 |
| InChI | InChI=1S/C32H43N7O2/c1-7-23(12-11-22(2)38-15-17-40-18-16-38)35-29-34-20-24-28(37-29)39(26-19-30(3,4)41-21-31(24,26)5)27-10-8-9-25(36-27)32(33-6)13-14-32/h7-12,20,26,33H,2,13-19,21H2,1,3-6H3,(H,34,35,37)/b12-11-,23-7+/t26-,31-/m1/s1 |
| InChIKey | PHRJFIHPCFFPCF-GDZCVOMQSA-N |
| XLogP | 4.77 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|