C15H15N5 — CID 174338010
8-benzyl-2-methylimidazo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 174338010) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-benzyl-2-methylimidazo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | 8-benzyl-2-methylimidazo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 174338010 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 8-benzyl-2-methylimidazo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn2cc(C)nc2c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H15N5/c1-10-8-20-9-13(14(16)17)19-12(15(20)18-10)7-11-5-3-2-4-6-11/h2-6,8-9H,7H2,1H3,(H3,16,17) |
| InChIKey | DULUALXCHFFUHY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|