C12H12F5N5O — CID 118561727
2-methoxy-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 118561727) has the molecular formula C12H12F5N5O and a molecular weight of 337.25 g/mol. Its IUPAC name is 2-methoxy-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | 2-methoxy-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 118561727 |
| Molecular Formula | C12H12F5N5O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-methoxy-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn2cc(OC)nc2c(CCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H12F5N5O/c1-23-8-5-22-4-7(9(18)19)20-6(10(22)21-8)2-3-11(13,14)12(15,16)17/h4-5H,2-3H2,1H3,(H3,18,19) |
| InChIKey | CZKWAQLSSMXCAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|