C11H10ClF5N6 — CID 122616711
3-chloro-1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide (PubChem CID 122616711) has the molecular formula C11H10ClF5N6 and a molecular weight of 356.69 g/mol. Its IUPAC name is 3-chloro-1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide.
| Compound Name | 3-chloro-1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 122616711 |
| Molecular Formula | C11H10ClF5N6 |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 3-chloro-1-methyl-6-(3,3,4,4,4-pentafluorobutyl)pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(CCC(F)(F)C(F)(F)F)nc2c1c(Cl)nn2C |
| InChI | InChI=1S/C11H10ClF5N6/c1-23-9-5(7(12)22-23)6(8(18)19)20-4(21-9)2-3-10(13,14)11(15,16)17/h2-3H2,1H3,(H3,18,19) |
| InChIKey | RUCRMHBLBSFLDU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|