C11H9F6N5 — CID 86715168
5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide (PubChem CID 86715168) has the molecular formula C11H9F6N5 and a molecular weight of 325.22 g/mol. Its IUPAC name is 5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide.
| Compound Name | 5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 86715168 |
| Molecular Formula | C11H9F6N5 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-fluoro-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1nn(CCC(F)(F)C(F)(F)F)c2ncc(F)cc12 |
| InChI | InChI=1S/C11H9F6N5/c12-5-3-6-7(8(18)19)21-22(9(6)20-4-5)2-1-10(13,14)11(15,16)17/h3-4H,1-2H2,(H3,18,19) |
| InChIKey | MUNDMGLIJOINMV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|