C12H12F5N5 — CID 157110168
2-imino-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanamine (PubChem CID 157110168) has the molecular formula C12H12F5N5 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-imino-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanamine.
| Compound Name | 2-imino-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanamine |
|---|---|
| PubChem CID | 157110168 |
| Molecular Formula | C12H12F5N5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-imino-2-[1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]ethanamine |
| SMILES | [H]/N=C(\CN)c1nn(CCC(F)(F)C(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C12H12F5N5/c13-11(14,12(15,16)17)3-5-22-10-7(2-1-4-20-10)9(21-22)8(19)6-18/h1-2,4,19H,3,5-6,18H2/b19-8+ |
| InChIKey | AGTITNKGNDXJEF-UFWORHAWSA-N |
| XLogP | 2.35 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|