C12H12F5N5 — CID 122616751
7-methyl-2-(3,3,4,4,4-pentafluorobutyl)pyrrolo[2,3-d]pyrimidine-4-carboximidamide (PubChem CID 122616751) has the molecular formula C12H12F5N5 and a molecular weight of 321.25 g/mol. Its IUPAC name is 7-methyl-2-(3,3,4,4,4-pentafluorobutyl)pyrrolo[2,3-d]pyrimidine-4-carboximidamide.
| Compound Name | 7-methyl-2-(3,3,4,4,4-pentafluorobutyl)pyrrolo[2,3-d]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 122616751 |
| Molecular Formula | C12H12F5N5 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 7-methyl-2-(3,3,4,4,4-pentafluorobutyl)pyrrolo[2,3-d]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(CCC(F)(F)C(F)(F)F)nc2c1ccn2C |
| InChI | InChI=1S/C12H12F5N5/c1-22-5-3-6-8(9(18)19)20-7(21-10(6)22)2-4-11(13,14)12(15,16)17/h3,5H,2,4H2,1H3,(H3,18,19) |
| InChIKey | XDVVCOBMZALKSG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|