C13H14F5N5 — CID 118566917
3-ethyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide (PubChem CID 118566917) has the molecular formula C13H14F5N5 and a molecular weight of 335.28 g/mol. Its IUPAC name is 3-ethyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide.
| Compound Name | 3-ethyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide |
|---|---|
| PubChem CID | 118566917 |
| Molecular Formula | C13H14F5N5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-ethyl-8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1cn2c(CC)cnc2c(CCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H14F5N5/c1-2-7-5-21-11-8(3-4-12(14,15)13(16,17)18)22-9(10(19)20)6-23(7)11/h5-6H,2-4H2,1H3,(H3,19,20) |
| InChIKey | FCRRUIUBIPTBIM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|