C11H10F5N5 — CID 86678983
1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide (PubChem CID 86678983) has the molecular formula C11H10F5N5 and a molecular weight of 307.23 g/mol. Its IUPAC name is 1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide.
| Compound Name | 1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 86678983 |
| Molecular Formula | C11H10F5N5 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1nn(CCC(F)(F)C(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C11H10F5N5/c12-10(13,11(14,15)16)3-5-21-9-6(2-1-4-19-9)7(20-21)8(17)18/h1-2,4H,3,5H2,(H3,17,18) |
| InChIKey | IJRFCFHOXDEGPS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|