C12H10ClF5N4 — CID 86678973
6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazole-3-carboximidamide (PubChem CID 86678973) has the molecular formula C12H10ClF5N4 and a molecular weight of 340.68 g/mol. Its IUPAC name is 6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazole-3-carboximidamide.
| Compound Name | 6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazole-3-carboximidamide |
|---|---|
| PubChem CID | 86678973 |
| Molecular Formula | C12H10ClF5N4 |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazole-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1nn(CCC(F)(F)C(F)(F)F)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H10ClF5N4/c13-6-1-2-7-8(5-6)22(21-9(7)10(19)20)4-3-11(14,15)12(16,17)18/h1-2,5H,3-4H2,(H3,19,20) |
| InChIKey | ORIXLFSGNBVWMU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|