C18H17OS- — CID 174352970
2,4-diethyl-10-methylidynethioxanthen-9-one (PubChem CID 174352970) has the molecular formula C18H17OS- and a molecular weight of 281.40 g/mol. Its IUPAC name is 2,4-diethyl-10-methylidynethioxanthen-9-one.
| Compound Name | 2,4-diethyl-10-methylidynethioxanthen-9-one |
|---|---|
| PubChem CID | 174352970 |
| Molecular Formula | C18H17OS- |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2,4-diethyl-10-methylidynethioxanthen-9-one |
| SMILES | C#[S-]1c2ccccc2C(=O)c2cc(CC)cc(CC)c21 |
| InChI | InChI=1S/C18H17OS/c1-4-12-10-13(5-2)18-15(11-12)17(19)14-8-6-7-9-16(14)20(18)3/h3,6-11H,4-5H2,1-2H3/q-1 |
| InChIKey | QXFSTNVPYDHTBL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|