About 1H-imidazole;1-(4-pentylphenyl)ethanone
1H-imidazole;1-(4-pentylphenyl)ethanone (PubChem CID 174356985) has the molecular formula C16H22N2O
and a molecular weight of 258.37 g/mol. Its IUPAC name is 1H-imidazole;1-(4-pentylphenyl)ethanone.
Molecular Properties
| Compound Name | 1H-imidazole;1-(4-pentylphenyl)ethanone |
| PubChem CID | 174356985 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1H-imidazole;1-(4-pentylphenyl)ethanone |
| SMILES | CCCCCc1ccc(C(C)=O)cc1.c1c[nH]cn1 |
| InChI | InChI=1S/C13H18O.C3H4N2/c1-3-4-5-6-12-7-9-13(10-8-12)11(2)14;1-2-5-3-4-1/h7-10H,3-6H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | ARIJHEJRVVFTLZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;1-(4-pentylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;1-(4-pentylphenyl)ethanone?
The IUPAC name of 1H-imidazole;1-(4-pentylphenyl)ethanone (CID 174356985) is 1H-imidazole;1-(4-pentylphenyl)ethanone.
What is the SMILES notation for 1H-imidazole;1-(4-pentylphenyl)ethanone?
The canonical SMILES for 1H-imidazole;1-(4-pentylphenyl)ethanone is CCCCCc1ccc(C(C)=O)cc1.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;1-(4-pentylphenyl)ethanone?
The InChIKey is ARIJHEJRVVFTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O.C3H4N2/c1-3-4-5-6-12-7-9-13(10-8-12)11(2)14;1-2-5-3-4-1/h7-10H,3-6H2,1-2H3;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;1-(4-pentylphenyl)ethanone?
1H-imidazole;1-(4-pentylphenyl)ethanone has a molecular weight of 258.37 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;1-(4-pentylphenyl)ethanone is sourced from PubChem (CID 174356985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).