C40H73N3S — CID 174360543
(8E)-1-N-(3-cycloundecylsulfanylprop-1-en-2-yl)-11-N-methyl-10-methylidene-14-N-non-8-enylpentadeca-8,14-diene-1,11,14-triamine (PubChem CID 174360543) has the molecular formula C40H73N3S and a molecular weight of 628.11 g/mol. Its IUPAC name is (8E)-1-N-(3-cycloundecylsulfanylprop-1-en-2-yl)-11-N-methyl-10-methylidene-14-N-non-8-enylpentadeca-8,14-diene-1,11,14-triamine.
| Compound Name | (8E)-1-N-(3-cycloundecylsulfanylprop-1-en-2-yl)-11-N-methyl-10-methylidene-14-N-non-8-enylpentadeca-8,14-diene-1,11,14-triamine |
|---|---|
| PubChem CID | 174360543 |
| Molecular Formula | C40H73N3S |
| Molecular Weight | 628.11 g/mol |
| Exact Mass | 627.55 |
| IUPAC Name | (8E)-1-N-(3-cycloundecylsulfanylprop-1-en-2-yl)-11-N-methyl-10-methylidene-14-N-non-8-enylpentadeca-8,14-diene-1,11,14-triamine |
| SMILES | C=CCCCCCCCNC(=C)CCC(NC)C(=C)/C=C/CCCCCCCNC(=C)CSC1CCCCCCCCCC1 |
| InChI | InChI=1S/C40H73N3S/c1-6-7-8-9-16-21-26-33-42-37(3)31-32-40(41-5)36(2)28-23-18-13-12-17-22-27-34-43-38(4)35-44-39-29-24-19-14-10-11-15-20-25-30-39/h6,23,28,39-43H,1-4,7-22,24-27,29-35H2,5H3/b28-23+ |
| InChIKey | QGSSSUNXLJYDTP-WEMUOSSPSA-N |
| XLogP | 11.56 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.11 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|