C30H39N5O4 — CID 174364175
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoxy]methyl]oxolane-3,4-diol (PubChem CID 174364175) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoxy]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoxy]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 174364175 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoxy]methyl]oxolane-3,4-diol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C30H39N5O4/c1-19(11-12-22-21(3)10-7-14-30(22,4)5)8-6-9-20(2)13-15-38-16-23-25(36)26(37)29(39-23)35-18-34-24-27(31)32-17-33-28(24)35/h6-13,17-18,23,25-26,29,36-37H,14-16H2,1-5H3,(H2,31,32,33)/b9-6+,12-11+,19-8+,20-13+/t23-,25-,26-,29-/m1/s1 |
| InChIKey | IXRPFQZNEALYAN-VYEWBRQMSA-N |
| XLogP | 4.35 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|