C25H22N4O2S — CID 174372656
N-carbamoyl-N-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 174372656) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-carbamoyl-N-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-carbamoyl-N-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 174372656 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-carbamoyl-N-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CC(=O)N(C(N)=O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C25H22N4O2S/c1-18(30)29(23(26)31)22-17-32-24(27-22)28-25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-17H,1H3,(H2,26,31)(H,27,28) |
| InChIKey | DOCSOEMBXDZLIG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|