C18H22N5O2P — CID 174377844
(2R)-2-[2-(6-aminopurin-9-yl)ethoxy]-2-phosphanyl-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 174377844) has the molecular formula C18H22N5O2P and a molecular weight of 371.38 g/mol. Its IUPAC name is (2R)-2-[2-(6-aminopurin-9-yl)ethoxy]-2-phosphanyl-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | (2R)-2-[2-(6-aminopurin-9-yl)ethoxy]-2-phosphanyl-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 174377844 |
| Molecular Formula | C18H22N5O2P |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R)-2-[2-(6-aminopurin-9-yl)ethoxy]-2-phosphanyl-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)[C@@H](P)OCCn2cnc3c(N)ncnc32)c(C)c1 |
| InChI | InChI=1S/C18H22N5O2P/c1-10-6-11(2)13(12(3)7-10)15(24)18(26)25-5-4-23-9-22-14-16(19)20-8-21-17(14)23/h6-9,18H,4-5,26H2,1-3H3,(H2,19,20,21)/t18-/m1/s1 |
| InChIKey | NNFHMDOZSDEKNC-GOSISDBHSA-N |
| XLogP | 2.43 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|