C14H13O4Zr- — CID 174381358
cyclopenta-1,3-diene;2-methylbenzene-1,3-dicarboxylic acid;zirconium (PubChem CID 174381358) has the molecular formula C14H13O4Zr- and a molecular weight of 336.48 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-methylbenzene-1,3-dicarboxylic acid;zirconium.
| Compound Name | cyclopenta-1,3-diene;2-methylbenzene-1,3-dicarboxylic acid;zirconium |
|---|---|
| PubChem CID | 174381358 |
| Molecular Formula | C14H13O4Zr- |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | cyclopenta-1,3-diene;2-methylbenzene-1,3-dicarboxylic acid;zirconium |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)O.[C-]1=CC=CC1.[Zr] |
| InChI | InChI=1S/C9H8O4.C5H5.Zr/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-2-4-5-3-1;/h2-4H,1H3,(H,10,11)(H,12,13);1-3H,4H2;/q;-1; |
| InChIKey | OVKNDOAIRGINLJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|