C11H10O8S3 — CID 174385765
naphthalen-1-yl(sulfinooxysulfonyl)methanesulfonic acid (PubChem CID 174385765) has the molecular formula C11H10O8S3 and a molecular weight of 366.39 g/mol. Its IUPAC name is naphthalen-1-yl(sulfinooxysulfonyl)methanesulfonic acid.
| Compound Name | naphthalen-1-yl(sulfinooxysulfonyl)methanesulfonic acid |
|---|---|
| PubChem CID | 174385765 |
| Molecular Formula | C11H10O8S3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | naphthalen-1-yl(sulfinooxysulfonyl)methanesulfonic acid |
| SMILES | O=S(O)OS(=O)(=O)C(c1cccc2ccccc12)S(=O)(=O)O |
| InChI | InChI=1S/C11H10O8S3/c12-20(13)19-22(17,18)11(21(14,15)16)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H,(H,12,13)(H,14,15,16) |
| InChIKey | WSYYBYBUONXAPJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|