C24H29NO5 — CID 174388879
1-benzoyl-3,3-diethoxy-4-phenylazetidin-2-one;butan-2-one (PubChem CID 174388879) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-benzoyl-3,3-diethoxy-4-phenylazetidin-2-one;butan-2-one.
| Compound Name | 1-benzoyl-3,3-diethoxy-4-phenylazetidin-2-one;butan-2-one |
|---|---|
| PubChem CID | 174388879 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-benzoyl-3,3-diethoxy-4-phenylazetidin-2-one;butan-2-one |
| SMILES | CCC(C)=O.CCOC1(OCC)C(=O)N(C(=O)c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H21NO4.C4H8O/c1-3-24-20(25-4-2)17(15-11-7-5-8-12-15)21(19(20)23)18(22)16-13-9-6-10-14-16;1-3-4(2)5/h5-14,17H,3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | KVPMFSLWELEONW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|